C17H28BrNO — CID 115817712
1-(3-bromo-4-methoxyphenyl)-4,6,6-trimethylheptan-2-amine (PubChem CID 115817712) has the molecular formula C17H28BrNO and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-4,6,6-trimethylheptan-2-amine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-4,6,6-trimethylheptan-2-amine |
|---|---|
| PubChem CID | 115817712 |
| Molecular Formula | C17H28BrNO |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-4,6,6-trimethylheptan-2-amine |
| SMILES | COc1ccc(CC(N)CC(C)CC(C)(C)C)cc1Br |
| InChI | InChI=1S/C17H28BrNO/c1-12(11-17(2,3)4)8-14(19)9-13-6-7-16(20-5)15(18)10-13/h6-7,10,12,14H,8-9,11,19H2,1-5H3 |
| InChIKey | SLIRECSMRYEDPD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |