C17H29N — CID 43138783
1-(2,4-dimethylphenyl)-3,5,5-trimethylhexan-1-amine (PubChem CID 43138783) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-3,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 43138783 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3,5,5-trimethylhexan-1-amine |
| SMILES | Cc1ccc(C(N)CC(C)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C17H29N/c1-12-7-8-15(14(3)9-12)16(18)10-13(2)11-17(4,5)6/h7-9,13,16H,10-11,18H2,1-6H3 |
| InChIKey | QSPNHLQUXZBDEO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |