C14H21Cl — CID 63430059
1-(1-chloro-3,3-dimethylbutyl)-2,4-dimethylbenzene (PubChem CID 63430059) has the molecular formula C14H21Cl and a molecular weight of 224.77 g/mol. Its IUPAC name is 1-(1-chloro-3,3-dimethylbutyl)-2,4-dimethylbenzene.
| Compound Name | 1-(1-chloro-3,3-dimethylbutyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 63430059 |
| Molecular Formula | C14H21Cl |
| Molecular Weight | 224.77 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(1-chloro-3,3-dimethylbutyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(Cl)CC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H21Cl/c1-10-6-7-12(11(2)8-10)13(15)9-14(3,4)5/h6-8,13H,9H2,1-5H3 |
| InChIKey | OLWNSCXNRNVJBQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|