About 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene
2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene (PubChem CID 58051292) has the molecular formula C14H21Cl
and a molecular weight of 224.77 g/mol. Its IUPAC name is 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene.
Analyze 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene?
The IUPAC name of 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene (CID 58051292) is 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene.
What is the SMILES notation for 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene?
The canonical SMILES for 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene is Cc1ccc(C(C)CC(C)(C)C)c(Cl)c1.
What is the InChIKey of 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene?
The InChIKey is JWPQQNWNGQNPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl/c1-10-6-7-12(13(15)8-10)11(2)9-14(3,4)5/h6-8,11H,9H2,1-5H3.
What are the key properties of 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene?
2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene has a molecular weight of 224.77 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(4,4-dimethylpentan-2-yl)-4-methylbenzene is sourced from PubChem (CID 58051292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).