C11H16Cl2FN — CID 171204622
(1R)-1-(2-chloro-5-fluorophenyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171204622) has the molecular formula C11H16Cl2FN and a molecular weight of 252.16 g/mol. Its IUPAC name is (1R)-1-(2-chloro-5-fluorophenyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-chloro-5-fluorophenyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171204622 |
| Molecular Formula | C11H16Cl2FN |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (1R)-1-(2-chloro-5-fluorophenyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)C[C@@H](N)c1cc(F)ccc1Cl.Cl |
| InChI | InChI=1S/C11H15ClFN.ClH/c1-7(2)5-11(14)9-6-8(13)3-4-10(9)12;/h3-4,6-7,11H,5,14H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | VHTAKEKWQWFNJD-RFVHGSKJSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |