C17H28FNO — CID 43485634
1-(5-fluoro-2-methoxyphenyl)-N,3,5,5-tetramethylhexan-1-amine (PubChem CID 43485634) has the molecular formula C17H28FNO and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-N,3,5,5-tetramethylhexan-1-amine.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-N,3,5,5-tetramethylhexan-1-amine |
|---|---|
| PubChem CID | 43485634 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-N,3,5,5-tetramethylhexan-1-amine |
| SMILES | CNC(CC(C)CC(C)(C)C)c1cc(F)ccc1OC |
| InChI | InChI=1S/C17H28FNO/c1-12(11-17(2,3)4)9-15(19-5)14-10-13(18)7-8-16(14)20-6/h7-8,10,12,15,19H,9,11H2,1-6H3 |
| InChIKey | MVKHQPKMYQPEEB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |