C15H20BrClF2 — CID 107477589
1-(1-bromo-3,5,5-trimethylhexyl)-2-chloro-4,5-difluorobenzene (PubChem CID 107477589) has the molecular formula C15H20BrClF2 and a molecular weight of 353.68 g/mol. Its IUPAC name is 1-(1-bromo-3,5,5-trimethylhexyl)-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-(1-bromo-3,5,5-trimethylhexyl)-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477589 |
| Molecular Formula | C15H20BrClF2 |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 1-(1-bromo-3,5,5-trimethylhexyl)-2-chloro-4,5-difluorobenzene |
| SMILES | CC(CC(Br)c1cc(F)c(F)cc1Cl)CC(C)(C)C |
| InChI | InChI=1S/C15H20BrClF2/c1-9(8-15(2,3)4)5-11(16)10-6-13(18)14(19)7-12(10)17/h6-7,9,11H,5,8H2,1-4H3 |
| InChIKey | JQWIZWOYNQQIHK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|