C9H6ClF5O — CID 107477160
1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-ol (PubChem CID 107477160) has the molecular formula C9H6ClF5O and a molecular weight of 260.59 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-ol.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 107477160 |
| Molecular Formula | C9H6ClF5O |
| Molecular Weight | 260.59 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3,3,3-trifluoropropan-1-ol |
| SMILES | OC(CC(F)(F)F)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C9H6ClF5O/c10-5-2-7(12)6(11)1-4(5)8(16)3-9(13,14)15/h1-2,8,16H,3H2 |
| InChIKey | VHRWOTCYLPQAOV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|