C17H23ClF2O — CID 107477167
(4-tert-butylcyclohexyl)-(2-chloro-4,5-difluorophenyl)methanol (PubChem CID 107477167) has the molecular formula C17H23ClF2O and a molecular weight of 316.82 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl)-(2-chloro-4,5-difluorophenyl)methanol.
| Compound Name | (4-tert-butylcyclohexyl)-(2-chloro-4,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 107477167 |
| Molecular Formula | C17H23ClF2O |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (4-tert-butylcyclohexyl)-(2-chloro-4,5-difluorophenyl)methanol |
| SMILES | CC(C)(C)C1CCC(C(O)c2cc(F)c(F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H23ClF2O/c1-17(2,3)11-6-4-10(5-7-11)16(21)12-8-14(19)15(20)9-13(12)18/h8-11,16,21H,4-7H2,1-3H3 |
| InChIKey | MDUFYPPXHMGINI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|