C11H11ClF2O — CID 115837947
(4-chloro-2,5-difluorophenyl)-cyclobutylmethanol (PubChem CID 115837947) has the molecular formula C11H11ClF2O and a molecular weight of 232.66 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-cyclobutylmethanol.
| Compound Name | (4-chloro-2,5-difluorophenyl)-cyclobutylmethanol |
|---|---|
| PubChem CID | 115837947 |
| Molecular Formula | C11H11ClF2O |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-cyclobutylmethanol |
| SMILES | OC(c1cc(F)c(Cl)cc1F)C1CCC1 |
| InChI | InChI=1S/C11H11ClF2O/c12-8-5-9(13)7(4-10(8)14)11(15)6-2-1-3-6/h4-6,11,15H,1-3H2 |
| InChIKey | RZWZQUVKXHJWHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|