C16H22ClF2N — CID 104992374
1-(4-chloro-2,5-difluorophenyl)-1-(3-ethylcyclohexyl)-N-methylmethanamine (PubChem CID 104992374) has the molecular formula C16H22ClF2N and a molecular weight of 301.81 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-1-(3-ethylcyclohexyl)-N-methylmethanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-1-(3-ethylcyclohexyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 104992374 |
| Molecular Formula | C16H22ClF2N |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-1-(3-ethylcyclohexyl)-N-methylmethanamine |
| SMILES | CCC1CCCC(C(NC)c2cc(F)c(Cl)cc2F)C1 |
| InChI | InChI=1S/C16H22ClF2N/c1-3-10-5-4-6-11(7-10)16(20-2)12-8-15(19)13(17)9-14(12)18/h8-11,16,20H,3-7H2,1-2H3 |
| InChIKey | KDPYDYJKRQKKBE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|