C14H18ClF2NO — CID 107138788
N-[(4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methyl]ethanamine (PubChem CID 107138788) has the molecular formula C14H18ClF2NO and a molecular weight of 289.75 g/mol. Its IUPAC name is N-[(4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methyl]ethanamine.
| Compound Name | N-[(4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107138788 |
| Molecular Formula | C14H18ClF2NO |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(F)c(Cl)cc1F)C1CCCOC1 |
| InChI | InChI=1S/C14H18ClF2NO/c1-2-18-14(9-4-3-5-19-8-9)10-6-13(17)11(15)7-12(10)16/h6-7,9,14,18H,2-5,8H2,1H3 |
| InChIKey | YTJNOHOLBHQSGW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|