C16H21ClN2O2 — CID 63012879
6-chloro-5-[ethylamino(oxan-3-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 63012879) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 6-chloro-5-[ethylamino(oxan-3-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[ethylamino(oxan-3-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63012879 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 6-chloro-5-[ethylamino(oxan-3-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | CCNC(c1cc2c(cc1Cl)NC(=O)C2)C1CCCOC1 |
| InChI | InChI=1S/C16H21ClN2O2/c1-2-18-16(10-4-3-5-21-9-10)12-6-11-7-15(20)19-14(11)8-13(12)17/h6,8,10,16,18H,2-5,7,9H2,1H3,(H,19,20) |
| InChIKey | YETWSKSVHWFMFL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |