C13H13ClF4N2O — CID 79648069
6-chloro-5-[1-(ethylamino)-2,2,3,3-tetrafluoropropyl]-1,3-dihydroindol-2-one (PubChem CID 79648069) has the molecular formula C13H13ClF4N2O and a molecular weight of 324.71 g/mol. Its IUPAC name is 6-chloro-5-[1-(ethylamino)-2,2,3,3-tetrafluoropropyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[1-(ethylamino)-2,2,3,3-tetrafluoropropyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79648069 |
| Molecular Formula | C13H13ClF4N2O |
| Molecular Weight | 324.71 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 6-chloro-5-[1-(ethylamino)-2,2,3,3-tetrafluoropropyl]-1,3-dihydroindol-2-one |
| SMILES | CCNC(c1cc2c(cc1Cl)NC(=O)C2)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H13ClF4N2O/c1-2-19-11(13(17,18)12(15)16)7-3-6-4-10(21)20-9(6)5-8(7)14/h3,5,11-12,19H,2,4H2,1H3,(H,20,21) |
| InChIKey | YFUJWVOFOPFSCQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.71 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|