C12H14ClNO2 — CID 61081464
6-chloro-5-(1-hydroxy-2-methylpropyl)-1,3-dihydroindol-2-one (PubChem CID 61081464) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 6-chloro-5-(1-hydroxy-2-methylpropyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(1-hydroxy-2-methylpropyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61081464 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 6-chloro-5-(1-hydroxy-2-methylpropyl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)C(O)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C12H14ClNO2/c1-6(2)12(16)8-3-7-4-11(15)14-10(7)5-9(8)13/h3,5-6,12,16H,4H2,1-2H3,(H,14,15) |
| InChIKey | WDKKDSCDZASHFP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |