C15H18ClNO2 — CID 61082859
6-chloro-5-[cyclohexyl(hydroxy)methyl]-1,3-dihydroindol-2-one (PubChem CID 61082859) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 6-chloro-5-[cyclohexyl(hydroxy)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[cyclohexyl(hydroxy)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61082859 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-chloro-5-[cyclohexyl(hydroxy)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)C3CCCCC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H18ClNO2/c16-12-8-13-10(7-14(18)17-13)6-11(12)15(19)9-4-2-1-3-5-9/h6,8-9,15,19H,1-5,7H2,(H,17,18) |
| InChIKey | WFHDHBIISGWDHC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |