C14H15BrClNO2 — CID 63015097
5-[bromo(oxan-3-yl)methyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 63015097) has the molecular formula C14H15BrClNO2 and a molecular weight of 344.64 g/mol. Its IUPAC name is 5-[bromo(oxan-3-yl)methyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo(oxan-3-yl)methyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63015097 |
| Molecular Formula | C14H15BrClNO2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 5-[bromo(oxan-3-yl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)C3CCCOC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C14H15BrClNO2/c15-14(8-2-1-3-19-7-8)10-4-9-5-13(18)17-12(9)6-11(10)16/h4,6,8,14H,1-3,5,7H2,(H,17,18) |
| InChIKey | ZODBMASMOWHMFI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|