C16H21BrClNO — CID 63443114
5-(1-bromooctyl)-6-chloro-1,3-dihydroindol-2-one (PubChem CID 63443114) has the molecular formula C16H21BrClNO and a molecular weight of 358.71 g/mol. Its IUPAC name is 5-(1-bromooctyl)-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-(1-bromooctyl)-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63443114 |
| Molecular Formula | C16H21BrClNO |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 5-(1-bromooctyl)-6-chloro-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCC(Br)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C16H21BrClNO/c1-2-3-4-5-6-7-13(17)12-8-11-9-16(20)19-15(11)10-14(12)18/h8,10,13H,2-7,9H2,1H3,(H,19,20) |
| InChIKey | FAIHUTAHYSFOKS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|