C15H9Br2Cl2NO — CID 63442972
5-[bromo-(4-bromo-2-chlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 63442972) has the molecular formula C15H9Br2Cl2NO and a molecular weight of 449.96 g/mol. Its IUPAC name is 5-[bromo-(4-bromo-2-chlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo-(4-bromo-2-chlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63442972 |
| Molecular Formula | C15H9Br2Cl2NO |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 446.84 |
| IUPAC Name | 5-[bromo-(4-bromo-2-chlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)c3ccc(Br)cc3Cl)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H9Br2Cl2NO/c16-8-1-2-9(11(18)5-8)15(17)10-3-7-4-14(21)20-13(7)6-12(10)19/h1-3,5-6,15H,4H2,(H,20,21) |
| InChIKey | KQVRACGAROJDND-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|