C15H9BrCl3NO — CID 63443106
5-[bromo-(2,3-dichlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 63443106) has the molecular formula C15H9BrCl3NO and a molecular weight of 405.51 g/mol. Its IUPAC name is 5-[bromo-(2,3-dichlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo-(2,3-dichlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63443106 |
| Molecular Formula | C15H9BrCl3NO |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 5-[bromo-(2,3-dichlorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)c3cccc(Cl)c3Cl)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H9BrCl3NO/c16-14(8-2-1-3-10(17)15(8)19)9-4-7-5-13(21)20-12(7)6-11(9)18/h1-4,6,14H,5H2,(H,20,21) |
| InChIKey | BDCMCMLVSRDSAS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|