C14H11BrClNO2S — CID 81124248
5-[bromo-(3-methoxythiophen-2-yl)methyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 81124248) has the molecular formula C14H11BrClNO2S and a molecular weight of 372.67 g/mol. Its IUPAC name is 5-[bromo-(3-methoxythiophen-2-yl)methyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo-(3-methoxythiophen-2-yl)methyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 81124248 |
| Molecular Formula | C14H11BrClNO2S |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 5-[bromo-(3-methoxythiophen-2-yl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | COc1ccsc1C(Br)c1cc2c(cc1Cl)NC(=O)C2 |
| InChI | InChI=1S/C14H11BrClNO2S/c1-19-11-2-3-20-14(11)13(15)8-4-7-5-12(18)17-10(7)6-9(8)16/h2-4,6,13H,5H2,1H3,(H,17,18) |
| InChIKey | ODZGPZFYRSEQOJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|