C14H10BrClFNOS — CID 80642266
6-[bromo-(3-chlorothiophen-2-yl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 80642266) has the molecular formula C14H10BrClFNOS and a molecular weight of 374.66 g/mol. Its IUPAC name is 6-[bromo-(3-chlorothiophen-2-yl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[bromo-(3-chlorothiophen-2-yl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 80642266 |
| Molecular Formula | C14H10BrClFNOS |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 6-[bromo-(3-chlorothiophen-2-yl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Br)c3sccc3Cl)c(F)cc2N1 |
| InChI | InChI=1S/C14H10BrClFNOS/c15-13(14-9(16)3-4-20-14)8-5-7-1-2-12(19)18-11(7)6-10(8)17/h3-6,13H,1-2H2,(H,18,19) |
| InChIKey | STKFJRQDRNVUNX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|