C16H12ClF2NO — CID 61086278
6-[chloro-(2-fluorophenyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61086278) has the molecular formula C16H12ClF2NO and a molecular weight of 307.73 g/mol. Its IUPAC name is 6-[chloro-(2-fluorophenyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[chloro-(2-fluorophenyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61086278 |
| Molecular Formula | C16H12ClF2NO |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 6-[chloro-(2-fluorophenyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)c3ccccc3F)c(F)cc2N1 |
| InChI | InChI=1S/C16H12ClF2NO/c17-16(10-3-1-2-4-12(10)18)11-7-9-5-6-15(21)20-14(9)8-13(11)19/h1-4,7-8,16H,5-6H2,(H,20,21) |
| InChIKey | HHRMKKWFIHWSRS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|