C12H9F6NO2 — CID 61083240
7-fluoro-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61083240) has the molecular formula C12H9F6NO2 and a molecular weight of 313.20 g/mol. Its IUPAC name is 7-fluoro-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-fluoro-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61083240 |
| Molecular Formula | C12H9F6NO2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 7-fluoro-6-(2,2,3,3,3-pentafluoro-1-hydroxypropyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(O)C(F)(F)C(F)(F)F)c(F)cc2N1 |
| InChI | InChI=1S/C12H9F6NO2/c13-7-4-8-5(1-2-9(20)19-8)3-6(7)10(21)11(14,15)12(16,17)18/h3-4,10,21H,1-2H2,(H,19,20) |
| InChIKey | UYIKLHGNYKJYEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|