C14H10BrClFNO2 — CID 61085252
6-[(5-bromofuran-2-yl)-chloromethyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61085252) has the molecular formula C14H10BrClFNO2 and a molecular weight of 358.59 g/mol. Its IUPAC name is 6-[(5-bromofuran-2-yl)-chloromethyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(5-bromofuran-2-yl)-chloromethyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61085252 |
| Molecular Formula | C14H10BrClFNO2 |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 6-[(5-bromofuran-2-yl)-chloromethyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Cl)c3ccc(Br)o3)c(F)cc2N1 |
| InChI | InChI=1S/C14H10BrClFNO2/c15-12-3-2-11(20-12)14(16)8-5-7-1-4-13(19)18-10(7)6-9(8)17/h2-3,5-6,14H,1,4H2,(H,18,19) |
| InChIKey | JCWOCDUAHSBQCF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|