C17H21BrFNO — CID 63442796
6-[bromo(cycloheptyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 63442796) has the molecular formula C17H21BrFNO and a molecular weight of 354.26 g/mol. Its IUPAC name is 6-[bromo(cycloheptyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[bromo(cycloheptyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 63442796 |
| Molecular Formula | C17H21BrFNO |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 6-[bromo(cycloheptyl)methyl]-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(Br)C3CCCCCC3)c(F)cc2N1 |
| InChI | InChI=1S/C17H21BrFNO/c18-17(11-5-3-1-2-4-6-11)13-9-12-7-8-16(21)20-15(12)10-14(13)19/h9-11,17H,1-8H2,(H,20,21) |
| InChIKey | GHOXVDMQJVXOAC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|