C17H23BrFNO — CID 63442754
6-(1-bromooctyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 63442754) has the molecular formula C17H23BrFNO and a molecular weight of 356.28 g/mol. Its IUPAC name is 6-(1-bromooctyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1-bromooctyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 63442754 |
| Molecular Formula | C17H23BrFNO |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 6-(1-bromooctyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCCCCCC(Br)c1cc2c(cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C17H23BrFNO/c1-2-3-4-5-6-7-14(18)13-10-12-8-9-17(21)20-16(12)11-15(13)19/h10-11,14H,2-9H2,1H3,(H,20,21) |
| InChIKey | KIHBLTYVHLKNJN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|