C13H8BrCl2NOS — CID 63797669
5-[(3-bromothiophen-2-yl)-chloromethyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 63797669) has the molecular formula C13H8BrCl2NOS and a molecular weight of 377.09 g/mol. Its IUPAC name is 5-[(3-bromothiophen-2-yl)-chloromethyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[(3-bromothiophen-2-yl)-chloromethyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63797669 |
| Molecular Formula | C13H8BrCl2NOS |
| Molecular Weight | 377.09 g/mol |
| Exact Mass | 374.89 |
| IUPAC Name | 5-[(3-bromothiophen-2-yl)-chloromethyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Cl)c3sccc3Br)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H8BrCl2NOS/c14-8-1-2-19-13(8)12(16)7-3-6-4-11(18)17-10(6)5-9(7)15/h1-3,5,12H,4H2,(H,17,18) |
| InChIKey | QLMCOXXOEPHOLT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.09 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|