C15H9Cl2F2NO — CID 62660055
6-chloro-5-[chloro-(2,3-difluorophenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 62660055) has the molecular formula C15H9Cl2F2NO and a molecular weight of 328.15 g/mol. Its IUPAC name is 6-chloro-5-[chloro-(2,3-difluorophenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[chloro-(2,3-difluorophenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62660055 |
| Molecular Formula | C15H9Cl2F2NO |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 6-chloro-5-[chloro-(2,3-difluorophenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Cl)c3cccc(F)c3F)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H9Cl2F2NO/c16-10-6-12-7(5-13(21)20-12)4-9(10)14(17)8-2-1-3-11(18)15(8)19/h1-4,6,14H,5H2,(H,20,21) |
| InChIKey | JSTIKDJCEQYHQA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|