C15H9BrClF2NO — CID 61097394
5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 61097394) has the molecular formula C15H9BrClF2NO and a molecular weight of 372.60 g/mol. Its IUPAC name is 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61097394 |
| Molecular Formula | C15H9BrClF2NO |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)c3ccc(F)cc3F)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H9BrClF2NO/c16-15(9-2-1-8(18)5-12(9)19)10-3-7-4-14(21)20-13(7)6-11(10)17/h1-3,5-6,15H,4H2,(H,20,21) |
| InChIKey | MASRYGSUEHSHCP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|