About 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one
5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 61097394) has the molecular formula C15H9BrClF2NO
and a molecular weight of 372.60 g/mol. Its IUPAC name is 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| PubChem CID | 61097394 |
| Molecular Formula | C15H9BrClF2NO |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)c3ccc(F)cc3F)c(Cl)cc2N1 |
| InChI | InChI=1S/C15H9BrClF2NO/c16-15(9-2-1-8(18)5-12(9)19)10-3-7-4-14(21)20-13(7)6-11(10)17/h1-3,5-6,15H,4H2,(H,20,21) |
| InChIKey | MASRYGSUEHSHCP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one?
The IUPAC name of 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one (CID 61097394) is 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one?
The canonical SMILES for 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one is O=C1Cc2cc(C(Br)c3ccc(F)cc3F)c(Cl)cc2N1.
What is the InChIKey of 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one?
The InChIKey is MASRYGSUEHSHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrClF2NO/c16-15(9-2-1-8(18)5-12(9)19)10-3-7-4-14(21)20-13(7)6-11(10)17/h1-3,5-6,15H,4H2,(H,20,21).
What are the key properties of 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one?
5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one has a molecular weight of 372.60 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo-(2,4-difluorophenyl)methyl]-6-chloro-1,3-dihydroindol-2-one is sourced from PubChem (CID 61097394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).