C14H16ClNO3 — CID 63013855
6-chloro-5-[hydroxy(oxan-3-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 63013855) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 6-chloro-5-[hydroxy(oxan-3-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[hydroxy(oxan-3-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63013855 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-chloro-5-[hydroxy(oxan-3-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(O)C3CCCOC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C14H16ClNO3/c15-11-6-12-9(5-13(17)16-12)4-10(11)14(18)8-2-1-3-19-7-8/h4,6,8,14,18H,1-3,5,7H2,(H,16,17) |
| InChIKey | CYEXISXJYLZMOR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |