C17H23Cl2NO — CID 63434327
6-chloro-5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydroindol-2-one (PubChem CID 63434327) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is 6-chloro-5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63434327 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 6-chloro-5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydroindol-2-one |
| SMILES | CC(CC(Cl)c1cc2c(cc1Cl)NC(=O)C2)CC(C)(C)C |
| InChI | InChI=1S/C17H23Cl2NO/c1-10(9-17(2,3)4)5-13(18)12-6-11-7-16(21)20-15(11)8-14(12)19/h6,8,10,13H,5,7,9H2,1-4H3,(H,20,21) |
| InChIKey | XRWZZXHTBKOSIT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|