C16H19Cl2NO2 — CID 103165684
6-chloro-5-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,3-dihydroindol-2-one (PubChem CID 103165684) has the molecular formula C16H19Cl2NO2 and a molecular weight of 328.24 g/mol. Its IUPAC name is 6-chloro-5-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 103165684 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 6-chloro-5-[1-chloro-2-(3-ethoxycyclobutyl)ethyl]-1,3-dihydroindol-2-one |
| SMILES | CCOC1CC(CC(Cl)c2cc3c(cc2Cl)NC(=O)C3)C1 |
| InChI | InChI=1S/C16H19Cl2NO2/c1-2-21-11-3-9(4-11)5-13(17)12-6-10-7-16(20)19-15(10)8-14(12)18/h6,8-9,11,13H,2-5,7H2,1H3,(H,19,20) |
| InChIKey | IBLMCUPWUWGSIJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|