C12H13ClF2O — CID 107477114
1-(2-chloro-4,5-difluorophenyl)-2-cyclobutylethanol (PubChem CID 107477114) has the molecular formula C12H13ClF2O and a molecular weight of 246.68 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-2-cyclobutylethanol.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-2-cyclobutylethanol |
|---|---|
| PubChem CID | 107477114 |
| Molecular Formula | C12H13ClF2O |
| Molecular Weight | 246.68 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-2-cyclobutylethanol |
| SMILES | OC(CC1CCC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H13ClF2O/c13-9-6-11(15)10(14)5-8(9)12(16)4-7-2-1-3-7/h5-7,12,16H,1-4H2 |
| InChIKey | IBBYWBXJNCCOBK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|