C13H16F2O — CID 61101489
2-cyclopentyl-1-(2,5-difluorophenyl)ethanol (PubChem CID 61101489) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-cyclopentyl-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 2-cyclopentyl-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 61101489 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-cyclopentyl-1-(2,5-difluorophenyl)ethanol |
| SMILES | OC(CC1CCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H16F2O/c14-10-5-6-12(15)11(8-10)13(16)7-9-3-1-2-4-9/h5-6,8-9,13,16H,1-4,7H2 |
| InChIKey | SGDYGZKHKIXAMN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |