C12H13BrF2O — CID 103165469
1-(4-bromo-2,5-difluorophenyl)-2-cyclobutylethanol (PubChem CID 103165469) has the molecular formula C12H13BrF2O and a molecular weight of 291.13 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-2-cyclobutylethanol.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-2-cyclobutylethanol |
|---|---|
| PubChem CID | 103165469 |
| Molecular Formula | C12H13BrF2O |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-2-cyclobutylethanol |
| SMILES | OC(CC1CCC1)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C12H13BrF2O/c13-9-6-10(14)8(5-11(9)15)12(16)4-7-2-1-3-7/h5-7,12,16H,1-4H2 |
| InChIKey | KWVGSXCOBOXPDO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|