C12H12Br2F2 — CID 103165898
1-bromo-4-(1-bromo-2-cyclobutylethyl)-2,5-difluorobenzene (PubChem CID 103165898) has the molecular formula C12H12Br2F2 and a molecular weight of 354.03 g/mol. Its IUPAC name is 1-bromo-4-(1-bromo-2-cyclobutylethyl)-2,5-difluorobenzene.
| Compound Name | 1-bromo-4-(1-bromo-2-cyclobutylethyl)-2,5-difluorobenzene |
|---|---|
| PubChem CID | 103165898 |
| Molecular Formula | C12H12Br2F2 |
| Molecular Weight | 354.03 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 1-bromo-4-(1-bromo-2-cyclobutylethyl)-2,5-difluorobenzene |
| SMILES | Fc1cc(C(Br)CC2CCC2)c(F)cc1Br |
| InChI | InChI=1S/C12H12Br2F2/c13-9(4-7-2-1-3-7)8-5-12(16)10(14)6-11(8)15/h5-7,9H,1-4H2 |
| InChIKey | JBLJAGLQFKZNRD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|