C14H17BrF2 — CID 79730955
1-(1-bromo-2-cyclopentylethyl)-2,4-difluoro-5-methylbenzene (PubChem CID 79730955) has the molecular formula C14H17BrF2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-(1-bromo-2-cyclopentylethyl)-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-(1-bromo-2-cyclopentylethyl)-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 79730955 |
| Molecular Formula | C14H17BrF2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(1-bromo-2-cyclopentylethyl)-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(C(Br)CC2CCCC2)c(F)cc1F |
| InChI | InChI=1S/C14H17BrF2/c1-9-6-11(14(17)8-13(9)16)12(15)7-10-4-2-3-5-10/h6,8,10,12H,2-5,7H2,1H3 |
| InChIKey | RVQHUOOVEXKEMZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|