C15H19BrF2O — CID 79731373
2-[3-bromo-3-(2,4-difluoro-5-methylphenyl)propyl]oxane (PubChem CID 79731373) has the molecular formula C15H19BrF2O and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-[3-bromo-3-(2,4-difluoro-5-methylphenyl)propyl]oxane.
| Compound Name | 2-[3-bromo-3-(2,4-difluoro-5-methylphenyl)propyl]oxane |
|---|---|
| PubChem CID | 79731373 |
| Molecular Formula | C15H19BrF2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-[3-bromo-3-(2,4-difluoro-5-methylphenyl)propyl]oxane |
| SMILES | Cc1cc(C(Br)CCC2CCCCO2)c(F)cc1F |
| InChI | InChI=1S/C15H19BrF2O/c1-10-8-12(15(18)9-14(10)17)13(16)6-5-11-4-2-3-7-19-11/h8-9,11,13H,2-7H2,1H3 |
| InChIKey | VLOVURITBRGBGK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|