C15H19ClF2O — CID 79730448
2-[3-chloro-3-(2,4-difluoro-5-methylphenyl)propyl]oxane (PubChem CID 79730448) has the molecular formula C15H19ClF2O and a molecular weight of 288.76 g/mol. Its IUPAC name is 2-[3-chloro-3-(2,4-difluoro-5-methylphenyl)propyl]oxane.
| Compound Name | 2-[3-chloro-3-(2,4-difluoro-5-methylphenyl)propyl]oxane |
|---|---|
| PubChem CID | 79730448 |
| Molecular Formula | C15H19ClF2O |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[3-chloro-3-(2,4-difluoro-5-methylphenyl)propyl]oxane |
| SMILES | Cc1cc(C(Cl)CCC2CCCCO2)c(F)cc1F |
| InChI | InChI=1S/C15H19ClF2O/c1-10-8-12(15(18)9-14(10)17)13(16)6-5-11-4-2-3-7-19-11/h8-9,11,13H,2-7H2,1H3 |
| InChIKey | JKUAOGJXGHESPB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|