C17H25ClO2 — CID 83067757
2-[3-chloro-3-(4-methoxy-3,5-dimethylphenyl)propyl]oxane (PubChem CID 83067757) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-[3-chloro-3-(4-methoxy-3,5-dimethylphenyl)propyl]oxane.
| Compound Name | 2-[3-chloro-3-(4-methoxy-3,5-dimethylphenyl)propyl]oxane |
|---|---|
| PubChem CID | 83067757 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[3-chloro-3-(4-methoxy-3,5-dimethylphenyl)propyl]oxane |
| SMILES | COc1c(C)cc(C(Cl)CCC2CCCCO2)cc1C |
| InChI | InChI=1S/C17H25ClO2/c1-12-10-14(11-13(2)17(12)19-3)16(18)8-7-15-6-4-5-9-20-15/h10-11,15-16H,4-9H2,1-3H3 |
| InChIKey | IQJIIPAMCXQHLI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|