C14H18BrClO2 — CID 65158142
2-[3-(3-bromo-4-methoxyphenyl)-3-chloropropyl]oxolane (PubChem CID 65158142) has the molecular formula C14H18BrClO2 and a molecular weight of 333.65 g/mol. Its IUPAC name is 2-[3-(3-bromo-4-methoxyphenyl)-3-chloropropyl]oxolane.
| Compound Name | 2-[3-(3-bromo-4-methoxyphenyl)-3-chloropropyl]oxolane |
|---|---|
| PubChem CID | 65158142 |
| Molecular Formula | C14H18BrClO2 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-[3-(3-bromo-4-methoxyphenyl)-3-chloropropyl]oxolane |
| SMILES | COc1ccc(C(Cl)CCC2CCCO2)cc1Br |
| InChI | InChI=1S/C14H18BrClO2/c1-17-14-7-4-10(9-12(14)15)13(16)6-5-11-3-2-8-18-11/h4,7,9,11,13H,2-3,5-6,8H2,1H3 |
| InChIKey | WUEFXIOEINLOBR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|