C11H13Br2ClOS — CID 80534126
2-[3-chloro-3-(4,5-dibromothiophen-2-yl)propyl]oxolane (PubChem CID 80534126) has the molecular formula C11H13Br2ClOS and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[3-chloro-3-(4,5-dibromothiophen-2-yl)propyl]oxolane.
| Compound Name | 2-[3-chloro-3-(4,5-dibromothiophen-2-yl)propyl]oxolane |
|---|---|
| PubChem CID | 80534126 |
| Molecular Formula | C11H13Br2ClOS |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | 2-[3-chloro-3-(4,5-dibromothiophen-2-yl)propyl]oxolane |
| SMILES | ClC(CCC1CCCO1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H13Br2ClOS/c12-8-6-10(16-11(8)13)9(14)4-3-7-2-1-5-15-7/h6-7,9H,1-5H2 |
| InChIKey | NGHAPGHOJLCJJZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|