C15H20BrClO3 — CID 65158101
2-[3-(2-bromo-4,5-dimethoxyphenyl)-3-chloropropyl]oxolane (PubChem CID 65158101) has the molecular formula C15H20BrClO3 and a molecular weight of 363.68 g/mol. Its IUPAC name is 2-[3-(2-bromo-4,5-dimethoxyphenyl)-3-chloropropyl]oxolane.
| Compound Name | 2-[3-(2-bromo-4,5-dimethoxyphenyl)-3-chloropropyl]oxolane |
|---|---|
| PubChem CID | 65158101 |
| Molecular Formula | C15H20BrClO3 |
| Molecular Weight | 363.68 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2-[3-(2-bromo-4,5-dimethoxyphenyl)-3-chloropropyl]oxolane |
| SMILES | COc1cc(Br)c(C(Cl)CCC2CCCO2)cc1OC |
| InChI | InChI=1S/C15H20BrClO3/c1-18-14-8-11(12(16)9-15(14)19-2)13(17)6-5-10-4-3-7-20-10/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | FNEKNHSUYAVYGE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|