C13H16BrClO3 — CID 61084782
2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]oxolane (PubChem CID 61084782) has the molecular formula C13H16BrClO3 and a molecular weight of 335.63 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]oxolane.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]oxolane |
|---|---|
| PubChem CID | 61084782 |
| Molecular Formula | C13H16BrClO3 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)-chloromethyl]oxolane |
| SMILES | COc1cc(Br)c(C(Cl)C2CCCO2)cc1OC |
| InChI | InChI=1S/C13H16BrClO3/c1-16-11-6-8(9(14)7-12(11)17-2)13(15)10-4-3-5-18-10/h6-7,10,13H,3-5H2,1-2H3 |
| InChIKey | HWNQWBQYDSYKQS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|