C12H13Br2ClO — CID 63429560
2-[chloro-(2,5-dibromophenyl)methyl]oxane (PubChem CID 63429560) has the molecular formula C12H13Br2ClO and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[chloro-(2,5-dibromophenyl)methyl]oxane.
| Compound Name | 2-[chloro-(2,5-dibromophenyl)methyl]oxane |
|---|---|
| PubChem CID | 63429560 |
| Molecular Formula | C12H13Br2ClO |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | 2-[chloro-(2,5-dibromophenyl)methyl]oxane |
| SMILES | ClC(c1cc(Br)ccc1Br)C1CCCCO1 |
| InChI | InChI=1S/C12H13Br2ClO/c13-8-4-5-10(14)9(7-8)12(15)11-3-1-2-6-16-11/h4-5,7,11-12H,1-3,6H2 |
| InChIKey | USSOSCWHULYOAL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|