C13H15Br2ClO — CID 81473158
2-[chloro-(2,5-dibromo-4-methylphenyl)methyl]oxane (PubChem CID 81473158) has the molecular formula C13H15Br2ClO and a molecular weight of 382.52 g/mol. Its IUPAC name is 2-[chloro-(2,5-dibromo-4-methylphenyl)methyl]oxane.
| Compound Name | 2-[chloro-(2,5-dibromo-4-methylphenyl)methyl]oxane |
|---|---|
| PubChem CID | 81473158 |
| Molecular Formula | C13H15Br2ClO |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 2-[chloro-(2,5-dibromo-4-methylphenyl)methyl]oxane |
| SMILES | Cc1cc(Br)c(C(Cl)C2CCCCO2)cc1Br |
| InChI | InChI=1S/C13H15Br2ClO/c1-8-6-11(15)9(7-10(8)14)13(16)12-4-2-3-5-17-12/h6-7,12-13H,2-5H2,1H3 |
| InChIKey | UQPGWSIMOOCBOA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|