C12H13Br3O2 — CID 81472980
2-[bromo-(2,5-dibromo-4-methylphenyl)methyl]-1,4-dioxane (PubChem CID 81472980) has the molecular formula C12H13Br3O2 and a molecular weight of 428.95 g/mol. Its IUPAC name is 2-[bromo-(2,5-dibromo-4-methylphenyl)methyl]-1,4-dioxane.
| Compound Name | 2-[bromo-(2,5-dibromo-4-methylphenyl)methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 81472980 |
| Molecular Formula | C12H13Br3O2 |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 425.85 |
| IUPAC Name | 2-[bromo-(2,5-dibromo-4-methylphenyl)methyl]-1,4-dioxane |
| SMILES | Cc1cc(Br)c(C(Br)C2COCCO2)cc1Br |
| InChI | InChI=1S/C12H13Br3O2/c1-7-4-10(14)8(5-9(7)13)12(15)11-6-16-2-3-17-11/h4-5,11-12H,2-3,6H2,1H3 |
| InChIKey | DNLALMJJRHCXAW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|