C18H25Br3 — CID 81474291
1,4-dibromo-2-[bromo-(4-tert-butylcyclohexyl)methyl]-5-methylbenzene (PubChem CID 81474291) has the molecular formula C18H25Br3 and a molecular weight of 481.11 g/mol. Its IUPAC name is 1,4-dibromo-2-[bromo-(4-tert-butylcyclohexyl)methyl]-5-methylbenzene.
| Compound Name | 1,4-dibromo-2-[bromo-(4-tert-butylcyclohexyl)methyl]-5-methylbenzene |
|---|---|
| PubChem CID | 81474291 |
| Molecular Formula | C18H25Br3 |
| Molecular Weight | 481.11 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | 1,4-dibromo-2-[bromo-(4-tert-butylcyclohexyl)methyl]-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C(Br)C2CCC(C(C)(C)C)CC2)cc1Br |
| InChI | InChI=1S/C18H25Br3/c1-11-9-16(20)14(10-15(11)19)17(21)12-5-7-13(8-6-12)18(2,3)4/h9-10,12-13,17H,5-8H2,1-4H3 |
| InChIKey | CMJAQHJPRHTFFL-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.11 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|