C16H17Br2Cl — CID 114097149
3-[chloro-(2,5-dibromo-4-methylphenyl)methyl]tricyclo[3.2.1.02,4]octane (PubChem CID 114097149) has the molecular formula C16H17Br2Cl and a molecular weight of 404.57 g/mol. Its IUPAC name is 3-[chloro-(2,5-dibromo-4-methylphenyl)methyl]tricyclo[3.2.1.02,4]octane.
| Compound Name | 3-[chloro-(2,5-dibromo-4-methylphenyl)methyl]tricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 114097149 |
| Molecular Formula | C16H17Br2Cl |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 3-[chloro-(2,5-dibromo-4-methylphenyl)methyl]tricyclo[3.2.1.02,4]octane |
| SMILES | Cc1cc(Br)c(C(Cl)C2C3C4CCC(C4)C32)cc1Br |
| InChI | InChI=1S/C16H17Br2Cl/c1-7-4-12(18)10(6-11(7)17)16(19)15-13-8-2-3-9(5-8)14(13)15/h4,6,8-9,13-16H,2-3,5H2,1H3 |
| InChIKey | MQZGYHUYADTNOO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|